C27H44N2O4 — CID 142247845
(13Z,15S)-4-hydroxy-5,5,7,9,15-pentamethyl-1-azacyclohexadec-13-ene-2,6-dione;2-methyl-4-[(Z)-prop-1-enyl]-1,3-oxazole (PubChem CID 142247845) has the molecular formula C27H44N2O4 and a molecular weight of 460.66 g/mol. Its IUPAC name is (13Z,15S)-4-hydroxy-5,5,7,9,15-pentamethyl-1-azacyclohexadec-13-ene-2,6-dione;2-methyl-4-[(Z)-prop-1-enyl]-1,3-oxazole.
| Compound Name | (13Z,15S)-4-hydroxy-5,5,7,9,15-pentamethyl-1-azacyclohexadec-13-ene-2,6-dione;2-methyl-4-[(Z)-prop-1-enyl]-1,3-oxazole |
|---|---|
| PubChem CID | 142247845 |
| Molecular Formula | C27H44N2O4 |
| Molecular Weight | 460.66 g/mol |
| Exact Mass | 460.33 |
| IUPAC Name | (13Z,15S)-4-hydroxy-5,5,7,9,15-pentamethyl-1-azacyclohexadec-13-ene-2,6-dione;2-methyl-4-[(Z)-prop-1-enyl]-1,3-oxazole |
| SMILES | C/C=C\c1coc(C)n1.CC1CCC/C=C\[C@H](C)CNC(=O)CC(O)C(C)(C)C(=O)C(C)C1 |
| InChI | InChI=1S/C20H35NO3.C7H9NO/c1-14-9-7-6-8-10-15(2)13-21-18(23)12-17(22)20(4,5)19(24)16(3)11-14;1-3-4-7-5-9-6(2)8-7/h8,10,14-17,22H,6-7,9,11-13H2,1-5H3,(H,21,23);3-5H,1-2H3/b10-8-;4-3-/t14?,15-,16?,17?;/m0./s1 |
| InChIKey | HINWYQPKQPSCLX-XDYUMRLASA-N |
| XLogP | 5.50 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.66 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|