C26H39ClN2O6 — CID 87797789
(3S,7S,10R,11S,12S)-3-[1-chloro-2-(2-methyl-1,3-oxazol-4-yl)ethenyl]-7,11-dihydroxy-8,8,10,12,16-pentamethyl-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 87797789) has the molecular formula C26H39ClN2O6 and a molecular weight of 511.06 g/mol. Its IUPAC name is (3S,7S,10R,11S,12S)-3-[1-chloro-2-(2-methyl-1,3-oxazol-4-yl)ethenyl]-7,11-dihydroxy-8,8,10,12,16-pentamethyl-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | (3S,7S,10R,11S,12S)-3-[1-chloro-2-(2-methyl-1,3-oxazol-4-yl)ethenyl]-7,11-dihydroxy-8,8,10,12,16-pentamethyl-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 87797789 |
| Molecular Formula | C26H39ClN2O6 |
| Molecular Weight | 511.06 g/mol |
| Exact Mass | 510.25 |
| IUPAC Name | (3S,7S,10R,11S,12S)-3-[1-chloro-2-(2-methyl-1,3-oxazol-4-yl)ethenyl]-7,11-dihydroxy-8,8,10,12,16-pentamethyl-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | Cc1nc(C=C(Cl)[C@@H]2CC3OC3(C)CCC[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)N2)co1 |
| InChI | InChI=1S/C26H39ClN2O6/c1-14-8-7-9-26(6)21(35-26)11-19(18(27)10-17-13-34-16(3)28-17)29-22(31)12-20(30)25(4,5)24(33)15(2)23(14)32/h10,13-15,19-21,23,30,32H,7-9,11-12H2,1-6H3,(H,29,31)/t14-,15+,19-,20-,21?,23-,26?/m0/s1 |
| InChIKey | SZXJIXHVVUVUOO-HFDVIDLKSA-N |
| XLogP | 3.76 |
| TPSA | 125.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.06 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|