C29H41ClN2O5S — CID 142652914
10-but-3-ynyl-3-[1-chloro-2-(2-methyl-1,3-thiazol-4-yl)ethenyl]-7,11-dihydroxy-8,8,12,16-tetramethyl-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 142652914) has the molecular formula C29H41ClN2O5S and a molecular weight of 565.18 g/mol. Its IUPAC name is 10-but-3-ynyl-3-[1-chloro-2-(2-methyl-1,3-thiazol-4-yl)ethenyl]-7,11-dihydroxy-8,8,12,16-tetramethyl-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | 10-but-3-ynyl-3-[1-chloro-2-(2-methyl-1,3-thiazol-4-yl)ethenyl]-7,11-dihydroxy-8,8,12,16-tetramethyl-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 142652914 |
| Molecular Formula | C29H41ClN2O5S |
| Molecular Weight | 565.18 g/mol |
| Exact Mass | 564.24 |
| IUPAC Name | 10-but-3-ynyl-3-[1-chloro-2-(2-methyl-1,3-thiazol-4-yl)ethenyl]-7,11-dihydroxy-8,8,12,16-tetramethyl-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | C#CCCC1C(=O)C(C)(C)C(O)CC(=O)NC(C(Cl)=Cc2csc(C)n2)CC2OC2(C)CCCC(C)C1O |
| InChI | InChI=1S/C29H41ClN2O5S/c1-7-8-11-20-26(35)17(2)10-9-12-29(6)24(37-29)14-22(21(30)13-19-16-38-18(3)31-19)32-25(34)15-23(33)28(4,5)27(20)36/h1,13,16-17,20,22-24,26,33,35H,8-12,14-15H2,2-6H3,(H,32,34) |
| InChIKey | GUWVHKMEMWYALS-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 112.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.18 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|