C28H41ClN2O5S — CID 142652892
3-[1-chloro-2-(2-methyl-1,3-thiazol-4-yl)ethenyl]-7,11-dihydroxy-8,8,12,16-tetramethyl-10-prop-2-enyl-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 142652892) has the molecular formula C28H41ClN2O5S and a molecular weight of 553.17 g/mol. Its IUPAC name is 3-[1-chloro-2-(2-methyl-1,3-thiazol-4-yl)ethenyl]-7,11-dihydroxy-8,8,12,16-tetramethyl-10-prop-2-enyl-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | 3-[1-chloro-2-(2-methyl-1,3-thiazol-4-yl)ethenyl]-7,11-dihydroxy-8,8,12,16-tetramethyl-10-prop-2-enyl-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 142652892 |
| Molecular Formula | C28H41ClN2O5S |
| Molecular Weight | 553.17 g/mol |
| Exact Mass | 552.24 |
| IUPAC Name | 3-[1-chloro-2-(2-methyl-1,3-thiazol-4-yl)ethenyl]-7,11-dihydroxy-8,8,12,16-tetramethyl-10-prop-2-enyl-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | C=CCC1C(=O)C(C)(C)C(O)CC(=O)NC(C(Cl)=Cc2csc(C)n2)CC2OC2(C)CCCC(C)C1O |
| InChI | InChI=1S/C28H41ClN2O5S/c1-7-9-19-25(34)16(2)10-8-11-28(6)23(36-28)13-21(20(29)12-18-15-37-17(3)30-18)31-24(33)14-22(32)27(4,5)26(19)35/h7,12,15-16,19,21-23,25,32,34H,1,8-11,13-14H2,2-6H3,(H,31,33) |
| InChIKey | KUHPTOCLFMSORG-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 112.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.17 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|