C29H46N2O5S — CID 10143405
(1S,3S,7S,10R,11S,12S,16R)-7,11-dihydroxy-8,8,12,16-tetramethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-10-propyl-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 10143405) has the molecular formula C29H46N2O5S and a molecular weight of 534.76 g/mol. Its IUPAC name is (1S,3S,7S,10R,11S,12S,16R)-7,11-dihydroxy-8,8,12,16-tetramethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-10-propyl-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | (1S,3S,7S,10R,11S,12S,16R)-7,11-dihydroxy-8,8,12,16-tetramethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-10-propyl-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 10143405 |
| Molecular Formula | C29H46N2O5S |
| Molecular Weight | 534.76 g/mol |
| Exact Mass | 534.31 |
| IUPAC Name | (1S,3S,7S,10R,11S,12S,16R)-7,11-dihydroxy-8,8,12,16-tetramethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-10-propyl-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | CCC[C@H]1C(=O)C(C)(C)[C@@H](O)CC(=O)N[C@H](/C(C)=C/c2csc(C)n2)C[C@@H]2O[C@]2(C)CCC[C@H](C)[C@@H]1O |
| InChI | InChI=1S/C29H46N2O5S/c1-8-10-21-26(34)17(2)11-9-12-29(7)24(36-29)14-22(18(3)13-20-16-37-19(4)30-20)31-25(33)15-23(32)28(5,6)27(21)35/h13,16-17,21-24,26,32,34H,8-12,14-15H2,1-7H3,(H,31,33)/b18-13+/t17-,21+,22-,23-,24-,26-,29+/m0/s1 |
| InChIKey | YQDVHKXWLAKRRZ-ZFOHUAGRSA-N |
| XLogP | 4.83 |
| TPSA | 112.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.76 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|