C27H41ClN2O5S — CID 142651823
3-[1-chloro-2-(2-methyl-1,3-thiazol-4-yl)ethenyl]-10-ethyl-7,11-dihydroxy-8,8,12,16-tetramethyl-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 142651823) has the molecular formula C27H41ClN2O5S and a molecular weight of 541.15 g/mol. Its IUPAC name is 3-[1-chloro-2-(2-methyl-1,3-thiazol-4-yl)ethenyl]-10-ethyl-7,11-dihydroxy-8,8,12,16-tetramethyl-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | 3-[1-chloro-2-(2-methyl-1,3-thiazol-4-yl)ethenyl]-10-ethyl-7,11-dihydroxy-8,8,12,16-tetramethyl-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 142651823 |
| Molecular Formula | C27H41ClN2O5S |
| Molecular Weight | 541.15 g/mol |
| Exact Mass | 540.24 |
| IUPAC Name | 3-[1-chloro-2-(2-methyl-1,3-thiazol-4-yl)ethenyl]-10-ethyl-7,11-dihydroxy-8,8,12,16-tetramethyl-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | CCC1C(=O)C(C)(C)C(O)CC(=O)NC(C(Cl)=Cc2csc(C)n2)CC2OC2(C)CCCC(C)C1O |
| InChI | InChI=1S/C27H41ClN2O5S/c1-7-18-24(33)15(2)9-8-10-27(6)22(35-27)12-20(19(28)11-17-14-36-16(3)29-17)30-23(32)13-21(31)26(4,5)25(18)34/h11,14-15,18,20-22,24,31,33H,7-10,12-13H2,1-6H3,(H,30,32) |
| InChIKey | WSMBLFHMFUNGEI-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 112.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.15 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|