C25H38N2O5S — CID 123638949
(1S,3S,7R,10R,11S,12S,16R)-7,11-dihydroxy-10,12,16-trimethyl-3-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 123638949) has the molecular formula C25H38N2O5S and a molecular weight of 478.66 g/mol. Its IUPAC name is (1S,3S,7R,10R,11S,12S,16R)-7,11-dihydroxy-10,12,16-trimethyl-3-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | (1S,3S,7R,10R,11S,12S,16R)-7,11-dihydroxy-10,12,16-trimethyl-3-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 123638949 |
| Molecular Formula | C25H38N2O5S |
| Molecular Weight | 478.66 g/mol |
| Exact Mass | 478.25 |
| IUPAC Name | (1S,3S,7R,10R,11S,12S,16R)-7,11-dihydroxy-10,12,16-trimethyl-3-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | CC(=Cc1csc(C)n1)[C@@H]1C[C@@H]2O[C@]2(C)CCC[C@H](C)[C@H](O)[C@@H](C)C(=O)C[C@@H](O)CC(=O)N1 |
| InChI | InChI=1S/C25H38N2O5S/c1-14-7-6-8-25(5)22(32-25)12-20(15(2)9-18-13-33-17(4)26-18)27-23(30)11-19(28)10-21(29)16(3)24(14)31/h9,13-14,16,19-20,22,24,28,31H,6-8,10-12H2,1-5H3,(H,27,30)/t14-,16-,19+,20-,22-,24-,25+/m0/s1 |
| InChIKey | OULTYKVANHCBHE-UJPAYEMISA-N |
| XLogP | 3.41 |
| TPSA | 112.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.66 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|