C28H43NO5S — CID 22978685
7,11-dihydroxy-8,8,10,12,16-pentamethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-17-oxabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 22978685) has the molecular formula C28H43NO5S and a molecular weight of 505.72 g/mol. Its IUPAC name is 7,11-dihydroxy-8,8,10,12,16-pentamethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-17-oxabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | 7,11-dihydroxy-8,8,10,12,16-pentamethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-17-oxabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 22978685 |
| Molecular Formula | C28H43NO5S |
| Molecular Weight | 505.72 g/mol |
| Exact Mass | 505.29 |
| IUPAC Name | 7,11-dihydroxy-8,8,10,12,16-pentamethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-17-oxabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | C/C(=C\c1csc(C)n1)C1CC(=O)CC(O)C(C)(C)C(=O)C(C)C(O)C(C)CCCC2(C)OC2C1 |
| InChI | InChI=1S/C28H43NO5S/c1-16-9-8-10-28(7)24(34-28)13-20(17(2)11-21-15-35-19(4)29-21)12-22(30)14-23(31)27(5,6)26(33)18(3)25(16)32/h11,15-16,18,20,23-25,31-32H,8-10,12-14H2,1-7H3/b17-11+ |
| InChIKey | QWUIALHSOSDGNS-GZTJUZNOSA-N |
| XLogP | 5.14 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.72 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|