C28H40FNO6S — CID 22770856
(3S,7R,10R,11S,12S)-3-[(Z)-1-fluoro-2-(2-methyl-1,3-thiazol-4-yl)ethenyl]-7,11-dihydroxy-8,8,12,16-tetramethyl-10-prop-2-enyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 22770856) has the molecular formula C28H40FNO6S and a molecular weight of 537.69 g/mol. Its IUPAC name is (3S,7R,10R,11S,12S)-3-[(Z)-1-fluoro-2-(2-methyl-1,3-thiazol-4-yl)ethenyl]-7,11-dihydroxy-8,8,12,16-tetramethyl-10-prop-2-enyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | (3S,7R,10R,11S,12S)-3-[(Z)-1-fluoro-2-(2-methyl-1,3-thiazol-4-yl)ethenyl]-7,11-dihydroxy-8,8,12,16-tetramethyl-10-prop-2-enyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 22770856 |
| Molecular Formula | C28H40FNO6S |
| Molecular Weight | 537.69 g/mol |
| Exact Mass | 537.26 |
| IUPAC Name | (3S,7R,10R,11S,12S)-3-[(Z)-1-fluoro-2-(2-methyl-1,3-thiazol-4-yl)ethenyl]-7,11-dihydroxy-8,8,12,16-tetramethyl-10-prop-2-enyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | C=CC[C@H]1C(=O)C(C)(C)[C@H](O)CC(=O)O[C@H](/C(F)=C/c2csc(C)n2)CC2OC2(C)CCC[C@H](C)[C@@H]1O |
| InChI | InChI=1S/C28H40FNO6S/c1-7-9-19-25(33)16(2)10-8-11-28(6)23(36-28)13-21(20(29)12-18-15-37-17(3)30-18)35-24(32)14-22(31)27(4,5)26(19)34/h7,12,15-16,19,21-23,25,31,33H,1,8-11,13-14H2,2-6H3/b20-12-/t16-,19+,21-,22+,23?,25-,28?/m0/s1 |
| InChIKey | IIGGFEPIAUXNQA-WPBODQOOSA-N |
| XLogP | 4.94 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.69 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|