C27H38FNO6S — CID 10174732
(3S,7R,10R,11S,12R)-3-[(Z)-1-fluoro-2-(2-methyl-1,3-thiazol-4-yl)ethenyl]-7,11-dihydroxy-10,12,16-trimethylspiro[4,17-dioxabicyclo[14.1.0]heptadecane-8,1'-cyclobutane]-5,9-dione (PubChem CID 10174732) has the molecular formula C27H38FNO6S and a molecular weight of 523.67 g/mol. Its IUPAC name is (3S,7R,10R,11S,12R)-3-[(Z)-1-fluoro-2-(2-methyl-1,3-thiazol-4-yl)ethenyl]-7,11-dihydroxy-10,12,16-trimethylspiro[4,17-dioxabicyclo[14.1.0]heptadecane-8,1'-cyclobutane]-5,9-dione.
| Compound Name | (3S,7R,10R,11S,12R)-3-[(Z)-1-fluoro-2-(2-methyl-1,3-thiazol-4-yl)ethenyl]-7,11-dihydroxy-10,12,16-trimethylspiro[4,17-dioxabicyclo[14.1.0]heptadecane-8,1'-cyclobutane]-5,9-dione |
|---|---|
| PubChem CID | 10174732 |
| Molecular Formula | C27H38FNO6S |
| Molecular Weight | 523.67 g/mol |
| Exact Mass | 523.24 |
| IUPAC Name | (3S,7R,10R,11S,12R)-3-[(Z)-1-fluoro-2-(2-methyl-1,3-thiazol-4-yl)ethenyl]-7,11-dihydroxy-10,12,16-trimethylspiro[4,17-dioxabicyclo[14.1.0]heptadecane-8,1'-cyclobutane]-5,9-dione |
| SMILES | Cc1nc(/C=C(\F)[C@@H]2CC3OC3(C)CCC[C@@H](C)[C@H](O)[C@@H](C)C(=O)C3(CCC3)[C@H](O)CC(=O)O2)cs1 |
| InChI | InChI=1S/C27H38FNO6S/c1-15-7-5-8-26(4)22(35-26)12-20(19(28)11-18-14-36-17(3)29-18)34-23(31)13-21(30)27(9-6-10-27)25(33)16(2)24(15)32/h11,14-16,20-22,24,30,32H,5-10,12-13H2,1-4H3/b19-11-/t15-,16-,20+,21-,22?,24+,26?/m1/s1 |
| InChIKey | OEVGSILAFDOHOO-ZNHVGYMXSA-N |
| XLogP | 4.53 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.67 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|