C26H38FNO6S — CID 87798164
(3S,7S,10R,11S,12S)-3-[1-fluoro-2-(2-methyl-1,3-thiazol-4-yl)ethenyl]-7,11-dihydroxy-8,8,10,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 87798164) has the molecular formula C26H38FNO6S and a molecular weight of 511.66 g/mol. Its IUPAC name is (3S,7S,10R,11S,12S)-3-[1-fluoro-2-(2-methyl-1,3-thiazol-4-yl)ethenyl]-7,11-dihydroxy-8,8,10,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | (3S,7S,10R,11S,12S)-3-[1-fluoro-2-(2-methyl-1,3-thiazol-4-yl)ethenyl]-7,11-dihydroxy-8,8,10,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 87798164 |
| Molecular Formula | C26H38FNO6S |
| Molecular Weight | 511.66 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | (3S,7S,10R,11S,12S)-3-[1-fluoro-2-(2-methyl-1,3-thiazol-4-yl)ethenyl]-7,11-dihydroxy-8,8,10,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | Cc1nc(C=C(F)[C@@H]2CC3OC3(C)CCC[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)O2)cs1 |
| InChI | InChI=1S/C26H38FNO6S/c1-14-8-7-9-26(6)21(34-26)11-19(18(27)10-17-13-35-16(3)28-17)33-22(30)12-20(29)25(4,5)24(32)15(2)23(14)31/h10,13-15,19-21,23,29,31H,7-9,11-12H2,1-6H3/t14-,15+,19-,20-,21?,23-,26?/m0/s1 |
| InChIKey | XHUMPCMGIUXOBK-HFDVIDLKSA-N |
| XLogP | 4.38 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.66 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|