C27H40FNO7S — CID 87852510
(1S,3S,10R,11S,12S,16R)-10-ethyl-3-[1-fluoro-2-[2-(hydroxymethyl)-1,3-thiazol-4-yl]ethenyl]-7,11-dihydroxy-8,8,12,16-tetramethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 87852510) has the molecular formula C27H40FNO7S and a molecular weight of 541.68 g/mol. Its IUPAC name is (1S,3S,10R,11S,12S,16R)-10-ethyl-3-[1-fluoro-2-[2-(hydroxymethyl)-1,3-thiazol-4-yl]ethenyl]-7,11-dihydroxy-8,8,12,16-tetramethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | (1S,3S,10R,11S,12S,16R)-10-ethyl-3-[1-fluoro-2-[2-(hydroxymethyl)-1,3-thiazol-4-yl]ethenyl]-7,11-dihydroxy-8,8,12,16-tetramethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 87852510 |
| Molecular Formula | C27H40FNO7S |
| Molecular Weight | 541.68 g/mol |
| Exact Mass | 541.25 |
| IUPAC Name | (1S,3S,10R,11S,12S,16R)-10-ethyl-3-[1-fluoro-2-[2-(hydroxymethyl)-1,3-thiazol-4-yl]ethenyl]-7,11-dihydroxy-8,8,12,16-tetramethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | CC[C@H]1C(=O)C(C)(C)C(O)CC(=O)O[C@H](C(F)=Cc2csc(CO)n2)C[C@@H]2O[C@]2(C)CCC[C@H](C)[C@@H]1O |
| InChI | InChI=1S/C27H40FNO7S/c1-6-17-24(33)15(2)8-7-9-27(5)21(36-27)11-19(18(28)10-16-14-37-22(13-30)29-16)35-23(32)12-20(31)26(3,4)25(17)34/h10,14-15,17,19-21,24,30-31,33H,6-9,11-13H2,1-5H3/t15-,17+,19-,20?,21-,24-,27+/m0/s1 |
| InChIKey | DWUYUBIBFQCDQG-WUELVIJUSA-N |
| XLogP | 3.96 |
| TPSA | 129.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.68 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|