C27H41NO7S — CID 91601604
(1R,3S,7S,10R,11S,12S,16S)-7,11-dihydroxy-3-[1-[2-(hydroxymethyl)-1,3-thiazol-4-yl]prop-1-en-2-yl]-8,8,10,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 91601604) has the molecular formula C27H41NO7S and a molecular weight of 523.69 g/mol. Its IUPAC name is (1R,3S,7S,10R,11S,12S,16S)-7,11-dihydroxy-3-[1-[2-(hydroxymethyl)-1,3-thiazol-4-yl]prop-1-en-2-yl]-8,8,10,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | (1R,3S,7S,10R,11S,12S,16S)-7,11-dihydroxy-3-[1-[2-(hydroxymethyl)-1,3-thiazol-4-yl]prop-1-en-2-yl]-8,8,10,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 91601604 |
| Molecular Formula | C27H41NO7S |
| Molecular Weight | 523.69 g/mol |
| Exact Mass | 523.26 |
| IUPAC Name | (1R,3S,7S,10R,11S,12S,16S)-7,11-dihydroxy-3-[1-[2-(hydroxymethyl)-1,3-thiazol-4-yl]prop-1-en-2-yl]-8,8,10,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | CC(=Cc1csc(CO)n1)[C@@H]1C[C@H]2O[C@@]2(C)CCC[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)O1 |
| InChI | InChI=1S/C27H41NO7S/c1-15-8-7-9-27(6)21(35-27)11-19(16(2)10-18-14-36-22(13-29)28-18)34-23(31)12-20(30)26(4,5)25(33)17(3)24(15)32/h10,14-15,17,19-21,24,29-30,32H,7-9,11-13H2,1-6H3/t15-,17+,19-,20-,21+,24-,27-/m0/s1 |
| InChIKey | UKIMCRYGLFQEOE-IXAHXTLISA-N |
| XLogP | 3.66 |
| TPSA | 129.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.69 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|