C29H45NO6S2 — CID 91023613
(1S,3R,7R,10S,11R,12R,16S)-3-[1-[2-(ethylsulfanylmethyl)-1,3-thiazol-4-yl]prop-1-en-2-yl]-7,11-dihydroxy-8,8,10,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 91023613) has the molecular formula C29H45NO6S2 and a molecular weight of 567.81 g/mol. Its IUPAC name is (1S,3R,7R,10S,11R,12R,16S)-3-[1-[2-(ethylsulfanylmethyl)-1,3-thiazol-4-yl]prop-1-en-2-yl]-7,11-dihydroxy-8,8,10,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | (1S,3R,7R,10S,11R,12R,16S)-3-[1-[2-(ethylsulfanylmethyl)-1,3-thiazol-4-yl]prop-1-en-2-yl]-7,11-dihydroxy-8,8,10,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 91023613 |
| Molecular Formula | C29H45NO6S2 |
| Molecular Weight | 567.81 g/mol |
| Exact Mass | 567.27 |
| IUPAC Name | (1S,3R,7R,10S,11R,12R,16S)-3-[1-[2-(ethylsulfanylmethyl)-1,3-thiazol-4-yl]prop-1-en-2-yl]-7,11-dihydroxy-8,8,10,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | CCSCc1nc(C=C(C)[C@H]2C[C@@H]3O[C@@]3(C)CCC[C@@H](C)[C@@H](O)[C@H](C)C(=O)C(C)(C)[C@H](O)CC(=O)O2)cs1 |
| InChI | InChI=1S/C29H45NO6S2/c1-8-37-16-24-30-20(15-38-24)12-18(3)21-13-23-29(7,36-23)11-9-10-17(2)26(33)19(4)27(34)28(5,6)22(31)14-25(32)35-21/h12,15,17,19,21-23,26,31,33H,8-11,13-14,16H2,1-7H3/t17-,19+,21-,22-,23+,26-,29+/m1/s1 |
| InChIKey | XMGKUVQIKZIZED-HDJSKPOISA-N |
| XLogP | 5.42 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.81 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|