C28H40FNO6 — CID 10391457
(1S,3S,7S,10R,11S,12S,16R)-10-ethyl-3-[(E)-1-fluoro-2-pyridin-2-ylethenyl]-7,11-dihydroxy-8,8,12,16-tetramethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 10391457) has the molecular formula C28H40FNO6 and a molecular weight of 505.63 g/mol. Its IUPAC name is (1S,3S,7S,10R,11S,12S,16R)-10-ethyl-3-[(E)-1-fluoro-2-pyridin-2-ylethenyl]-7,11-dihydroxy-8,8,12,16-tetramethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | (1S,3S,7S,10R,11S,12S,16R)-10-ethyl-3-[(E)-1-fluoro-2-pyridin-2-ylethenyl]-7,11-dihydroxy-8,8,12,16-tetramethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 10391457 |
| Molecular Formula | C28H40FNO6 |
| Molecular Weight | 505.63 g/mol |
| Exact Mass | 505.28 |
| IUPAC Name | (1S,3S,7S,10R,11S,12S,16R)-10-ethyl-3-[(E)-1-fluoro-2-pyridin-2-ylethenyl]-7,11-dihydroxy-8,8,12,16-tetramethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | CC[C@H]1C(=O)C(C)(C)[C@@H](O)CC(=O)O[C@H](/C(F)=C\c2ccccn2)C[C@@H]2O[C@]2(C)CCC[C@H](C)[C@@H]1O |
| InChI | InChI=1S/C28H40FNO6/c1-6-19-25(33)17(2)10-9-12-28(5)23(36-28)15-21(20(29)14-18-11-7-8-13-30-18)35-24(32)16-22(31)27(3,4)26(19)34/h7-8,11,13-14,17,19,21-23,25,31,33H,6,9-10,12,15-16H2,1-5H3/b20-14+/t17-,19+,21-,22-,23-,25-,28+/m0/s1 |
| InChIKey | ZNCCJSKMOCINCD-QFUKGOMDSA-N |
| XLogP | 4.40 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.63 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|