C30H45NO6 — CID 90984970
(3S,7S,10R,11R,12S)-7,11-dihydroxy-8,8,12,16-tetramethyl-10-propyl-3-(1-pyridin-2-ylprop-1-en-2-yl)-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 90984970) has the molecular formula C30H45NO6 and a molecular weight of 515.69 g/mol. Its IUPAC name is (3S,7S,10R,11R,12S)-7,11-dihydroxy-8,8,12,16-tetramethyl-10-propyl-3-(1-pyridin-2-ylprop-1-en-2-yl)-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | (3S,7S,10R,11R,12S)-7,11-dihydroxy-8,8,12,16-tetramethyl-10-propyl-3-(1-pyridin-2-ylprop-1-en-2-yl)-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 90984970 |
| Molecular Formula | C30H45NO6 |
| Molecular Weight | 515.69 g/mol |
| Exact Mass | 515.32 |
| IUPAC Name | (3S,7S,10R,11R,12S)-7,11-dihydroxy-8,8,12,16-tetramethyl-10-propyl-3-(1-pyridin-2-ylprop-1-en-2-yl)-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | CCC[C@@H]1C(=O)C(C)(C)[C@@H](O)CC(=O)O[C@H](C(C)=Cc2ccccn2)CC2OC2(C)CCC[C@H](C)[C@H]1O |
| InChI | InChI=1S/C30H45NO6/c1-7-11-22-27(34)19(2)12-10-14-30(6)25(37-30)17-23(20(3)16-21-13-8-9-15-31-21)36-26(33)18-24(32)29(4,5)28(22)35/h8-9,13,15-16,19,22-25,27,32,34H,7,10-12,14,17-18H2,1-6H3/t19-,22-,23-,24-,25?,27+,30?/m0/s1 |
| InChIKey | ABMJZZKAWDHBGV-ISSRBLSOSA-N |
| XLogP | 4.89 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.69 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|