C32H48N2O5 — CID 54447149
7,11-dihydroxy-8,8,12,16-tetramethyl-10-(3-methylbut-2-enyl)-3-(1-pyridin-2-ylprop-1-en-2-yl)-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 54447149) has the molecular formula C32H48N2O5 and a molecular weight of 540.75 g/mol. Its IUPAC name is 7,11-dihydroxy-8,8,12,16-tetramethyl-10-(3-methylbut-2-enyl)-3-(1-pyridin-2-ylprop-1-en-2-yl)-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | 7,11-dihydroxy-8,8,12,16-tetramethyl-10-(3-methylbut-2-enyl)-3-(1-pyridin-2-ylprop-1-en-2-yl)-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 54447149 |
| Molecular Formula | C32H48N2O5 |
| Molecular Weight | 540.75 g/mol |
| Exact Mass | 540.36 |
| IUPAC Name | 7,11-dihydroxy-8,8,12,16-tetramethyl-10-(3-methylbut-2-enyl)-3-(1-pyridin-2-ylprop-1-en-2-yl)-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | CC(C)=CCC1C(=O)C(C)(C)C(O)CC(=O)NC(C(C)=Cc2ccccn2)CC2OC2(C)CCCC(C)C1O |
| InChI | InChI=1S/C32H48N2O5/c1-20(2)13-14-24-29(37)21(3)11-10-15-32(7)27(39-32)18-25(22(4)17-23-12-8-9-16-33-23)34-28(36)19-26(35)31(5,6)30(24)38/h8-9,12-13,16-17,21,24-27,29,35,37H,10-11,14-15,18-19H2,1-7H3,(H,34,36) |
| InChIKey | WSHYUSWAZNBMMZ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 112.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.75 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|