C31H48N2O6 — CID 142652911
7,11-dihydroxy-8,8,12,16-tetramethyl-10-(3-methylbut-2-enyl)-3-[1-(2-methyl-1,3-oxazol-4-yl)prop-1-en-2-yl]-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 142652911) has the molecular formula C31H48N2O6 and a molecular weight of 544.73 g/mol. Its IUPAC name is 7,11-dihydroxy-8,8,12,16-tetramethyl-10-(3-methylbut-2-enyl)-3-[1-(2-methyl-1,3-oxazol-4-yl)prop-1-en-2-yl]-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | 7,11-dihydroxy-8,8,12,16-tetramethyl-10-(3-methylbut-2-enyl)-3-[1-(2-methyl-1,3-oxazol-4-yl)prop-1-en-2-yl]-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 142652911 |
| Molecular Formula | C31H48N2O6 |
| Molecular Weight | 544.73 g/mol |
| Exact Mass | 544.35 |
| IUPAC Name | 7,11-dihydroxy-8,8,12,16-tetramethyl-10-(3-methylbut-2-enyl)-3-[1-(2-methyl-1,3-oxazol-4-yl)prop-1-en-2-yl]-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | CC(C)=CCC1C(=O)C(C)(C)C(O)CC(=O)NC(C(C)=Cc2coc(C)n2)CC2OC2(C)CCCC(C)C1O |
| InChI | InChI=1S/C31H48N2O6/c1-18(2)11-12-23-28(36)19(3)10-9-13-31(8)26(39-31)15-24(20(4)14-22-17-38-21(5)32-22)33-27(35)16-25(34)30(6,7)29(23)37/h11,14,17,19,23-26,28,34,36H,9-10,12-13,15-16H2,1-8H3,(H,33,35) |
| InChIKey | COVFLKCFTFGVAX-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 125.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.73 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|