C32H46N2O6 — CID 91038257
(3S,7S,10R,11R,12S)-7,11-dihydroxy-8,8,12,16-tetramethyl-3-(2-methyl-1,3-benzoxazol-5-yl)-10-(3-methylbut-2-enyl)-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 91038257) has the molecular formula C32H46N2O6 and a molecular weight of 554.73 g/mol. Its IUPAC name is (3S,7S,10R,11R,12S)-7,11-dihydroxy-8,8,12,16-tetramethyl-3-(2-methyl-1,3-benzoxazol-5-yl)-10-(3-methylbut-2-enyl)-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | (3S,7S,10R,11R,12S)-7,11-dihydroxy-8,8,12,16-tetramethyl-3-(2-methyl-1,3-benzoxazol-5-yl)-10-(3-methylbut-2-enyl)-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 91038257 |
| Molecular Formula | C32H46N2O6 |
| Molecular Weight | 554.73 g/mol |
| Exact Mass | 554.34 |
| IUPAC Name | (3S,7S,10R,11R,12S)-7,11-dihydroxy-8,8,12,16-tetramethyl-3-(2-methyl-1,3-benzoxazol-5-yl)-10-(3-methylbut-2-enyl)-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | CC(C)=CC[C@H]1C(=O)C(C)(C)[C@@H](O)CC(=O)N[C@H](c2ccc3oc(C)nc3c2)CC2OC2(C)CCC[C@H](C)[C@H]1O |
| InChI | InChI=1S/C32H46N2O6/c1-18(2)10-12-22-29(37)19(3)9-8-14-32(7)27(40-32)16-23(21-11-13-25-24(15-21)33-20(4)39-25)34-28(36)17-26(35)31(5,6)30(22)38/h10-11,13,15,19,22-23,26-27,29,35,37H,8-9,12,14,16-17H2,1-7H3,(H,34,36)/t19-,22+,23-,26-,27?,29+,32?/m0/s1 |
| InChIKey | KDRNEGWRSSKPND-XEGQFTMQSA-N |
| XLogP | 5.34 |
| TPSA | 125.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.73 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|