C31H44N2O5S — CID 142688121
10-but-3-enyl-7,11-dihydroxy-8,8,12,16-tetramethyl-3-(2-methyl-1,3-benzothiazol-5-yl)-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 142688121) has the molecular formula C31H44N2O5S and a molecular weight of 556.77 g/mol. Its IUPAC name is 10-but-3-enyl-7,11-dihydroxy-8,8,12,16-tetramethyl-3-(2-methyl-1,3-benzothiazol-5-yl)-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | 10-but-3-enyl-7,11-dihydroxy-8,8,12,16-tetramethyl-3-(2-methyl-1,3-benzothiazol-5-yl)-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 142688121 |
| Molecular Formula | C31H44N2O5S |
| Molecular Weight | 556.77 g/mol |
| Exact Mass | 556.30 |
| IUPAC Name | 10-but-3-enyl-7,11-dihydroxy-8,8,12,16-tetramethyl-3-(2-methyl-1,3-benzothiazol-5-yl)-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | C=CCCC1C(=O)C(C)(C)C(O)CC(=O)NC(c2ccc3sc(C)nc3c2)CC2OC2(C)CCCC(C)C1O |
| InChI | InChI=1S/C31H44N2O5S/c1-7-8-11-21-28(36)18(2)10-9-14-31(6)26(38-31)16-22(20-12-13-24-23(15-20)32-19(3)39-24)33-27(35)17-25(34)30(4,5)29(21)37/h7,12-13,15,18,21-22,25-26,28,34,36H,1,8-11,14,16-17H2,2-6H3,(H,33,35) |
| InChIKey | DNYIMXUMPFPPEZ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 112.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.77 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|