C32H44N2O5 — CID 142688124
10-but-3-enyl-7,11-dihydroxy-8,8,12,16-tetramethyl-3-quinolin-7-yl-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 142688124) has the molecular formula C32H44N2O5 and a molecular weight of 536.71 g/mol. Its IUPAC name is 10-but-3-enyl-7,11-dihydroxy-8,8,12,16-tetramethyl-3-quinolin-7-yl-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | 10-but-3-enyl-7,11-dihydroxy-8,8,12,16-tetramethyl-3-quinolin-7-yl-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 142688124 |
| Molecular Formula | C32H44N2O5 |
| Molecular Weight | 536.71 g/mol |
| Exact Mass | 536.33 |
| IUPAC Name | 10-but-3-enyl-7,11-dihydroxy-8,8,12,16-tetramethyl-3-quinolin-7-yl-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | C=CCCC1C(=O)C(C)(C)C(O)CC(=O)NC(c2ccc3cccnc3c2)CC2OC2(C)CCCC(C)C1O |
| InChI | InChI=1S/C32H44N2O5/c1-6-7-12-23-29(37)20(2)10-8-15-32(5)27(39-32)18-25(22-14-13-21-11-9-16-33-24(21)17-22)34-28(36)19-26(35)31(3,4)30(23)38/h6,9,11,13-14,16-17,20,23,25-27,29,35,37H,1,7-8,10,12,15,18-19H2,2-5H3,(H,34,36) |
| InChIKey | XXPAIKQBIDMQNV-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 112.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.71 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|