C29H39NO6 — CID 59890446
(1S,3S,11S,16R)-7,11-dihydroxy-8,8,10,12,16-pentamethyl-3-quinolin-7-yl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 59890446) has the molecular formula C29H39NO6 and a molecular weight of 497.63 g/mol. Its IUPAC name is (1S,3S,11S,16R)-7,11-dihydroxy-8,8,10,12,16-pentamethyl-3-quinolin-7-yl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | (1S,3S,11S,16R)-7,11-dihydroxy-8,8,10,12,16-pentamethyl-3-quinolin-7-yl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 59890446 |
| Molecular Formula | C29H39NO6 |
| Molecular Weight | 497.63 g/mol |
| Exact Mass | 497.28 |
| IUPAC Name | (1S,3S,11S,16R)-7,11-dihydroxy-8,8,10,12,16-pentamethyl-3-quinolin-7-yl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | CC1CCC[C@@]2(C)O[C@H]2C[C@@H](c2ccc3cccnc3c2)OC(=O)CC(O)C(C)(C)C(=O)C(C)[C@H]1O |
| InChI | InChI=1S/C29H39NO6/c1-17-8-6-12-29(5)24(36-29)15-22(20-11-10-19-9-7-13-30-21(19)14-20)35-25(32)16-23(31)28(3,4)27(34)18(2)26(17)33/h7,9-11,13-14,17-18,22-24,26,31,33H,6,8,12,15-16H2,1-5H3/t17?,18?,22-,23?,24-,26-,29+/m0/s1 |
| InChIKey | VJSBAXNETLHRTF-DEISPPAYSA-N |
| XLogP | 4.53 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.63 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|