C30H41NO6 — CID 59890424
(1S,3S,11S,16R)-7,11-dihydroxy-8,8,10,12,16-pentamethyl-3-(4-methylquinolin-7-yl)-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 59890424) has the molecular formula C30H41NO6 and a molecular weight of 511.66 g/mol. Its IUPAC name is (1S,3S,11S,16R)-7,11-dihydroxy-8,8,10,12,16-pentamethyl-3-(4-methylquinolin-7-yl)-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | (1S,3S,11S,16R)-7,11-dihydroxy-8,8,10,12,16-pentamethyl-3-(4-methylquinolin-7-yl)-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 59890424 |
| Molecular Formula | C30H41NO6 |
| Molecular Weight | 511.66 g/mol |
| Exact Mass | 511.29 |
| IUPAC Name | (1S,3S,11S,16R)-7,11-dihydroxy-8,8,10,12,16-pentamethyl-3-(4-methylquinolin-7-yl)-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | Cc1ccnc2cc([C@@H]3C[C@@H]4O[C@]4(C)CCCC(C)[C@H](O)C(C)C(=O)C(C)(C)C(O)CC(=O)O3)ccc12 |
| InChI | InChI=1S/C30H41NO6/c1-17-11-13-31-22-14-20(9-10-21(17)22)23-15-25-30(6,37-25)12-7-8-18(2)27(34)19(3)28(35)29(4,5)24(32)16-26(33)36-23/h9-11,13-14,18-19,23-25,27,32,34H,7-8,12,15-16H2,1-6H3/t18?,19?,23-,24?,25-,27-,30+/m0/s1 |
| InChIKey | FGIXXHKASIFOEF-MDJRGWBLSA-N |
| XLogP | 4.84 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.66 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|