C31H47N3O6 — CID 21333966
3-[1-[2-(dimethylamino)ethyl]benzimidazol-5-yl]-7,11-dihydroxy-8,8,10,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 21333966) has the molecular formula C31H47N3O6 and a molecular weight of 557.73 g/mol. Its IUPAC name is 3-[1-[2-(dimethylamino)ethyl]benzimidazol-5-yl]-7,11-dihydroxy-8,8,10,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | 3-[1-[2-(dimethylamino)ethyl]benzimidazol-5-yl]-7,11-dihydroxy-8,8,10,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 21333966 |
| Molecular Formula | C31H47N3O6 |
| Molecular Weight | 557.73 g/mol |
| Exact Mass | 557.35 |
| IUPAC Name | 3-[1-[2-(dimethylamino)ethyl]benzimidazol-5-yl]-7,11-dihydroxy-8,8,10,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | CC1CCCC2(C)OC2CC(c2ccc3c(c2)ncn3CCN(C)C)OC(=O)CC(O)C(C)(C)C(=O)C(C)C1O |
| InChI | InChI=1S/C31H47N3O6/c1-19-9-8-12-31(5)26(40-31)16-24(21-10-11-23-22(15-21)32-18-34(23)14-13-33(6)7)39-27(36)17-25(35)30(3,4)29(38)20(2)28(19)37/h10-11,15,18-20,24-26,28,35,37H,8-9,12-14,16-17H2,1-7H3 |
| InChIKey | ONSUZHGGNNQFRC-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.73 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|