C29H43N3O5 — CID 91240669
(8S,16S)-16-[1-(2-aminoethyl)benzimidazol-5-yl]-4,8-dihydroxy-5,5,7,9,13-pentamethyl-1-oxacyclohexadec-13-ene-2,6-dione (PubChem CID 91240669) has the molecular formula C29H43N3O5 and a molecular weight of 513.68 g/mol. Its IUPAC name is (8S,16S)-16-[1-(2-aminoethyl)benzimidazol-5-yl]-4,8-dihydroxy-5,5,7,9,13-pentamethyl-1-oxacyclohexadec-13-ene-2,6-dione.
| Compound Name | (8S,16S)-16-[1-(2-aminoethyl)benzimidazol-5-yl]-4,8-dihydroxy-5,5,7,9,13-pentamethyl-1-oxacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 91240669 |
| Molecular Formula | C29H43N3O5 |
| Molecular Weight | 513.68 g/mol |
| Exact Mass | 513.32 |
| IUPAC Name | (8S,16S)-16-[1-(2-aminoethyl)benzimidazol-5-yl]-4,8-dihydroxy-5,5,7,9,13-pentamethyl-1-oxacyclohexadec-13-ene-2,6-dione |
| SMILES | CC1=CC[C@@H](c2ccc3c(c2)ncn3CCN)OC(=O)CC(O)C(C)(C)C(=O)C(C)[C@@H](O)C(C)CCC1 |
| InChI | InChI=1S/C29H43N3O5/c1-18-7-6-8-19(2)27(35)20(3)28(36)29(4,5)25(33)16-26(34)37-24(12-9-18)21-10-11-23-22(15-21)31-17-32(23)14-13-30/h9-11,15,17,19-20,24-25,27,33,35H,6-8,12-14,16,30H2,1-5H3/t19?,20?,24-,25?,27-/m0/s1 |
| InChIKey | NHJGPWIDCWHYND-VVAYGAQISA-N |
| XLogP | 4.08 |
| TPSA | 127.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.68 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|