C28H39NO5 — CID 142001555
(7R,9S,13Z)-8-hydroxy-5,5,7,9,13-pentamethyl-16-(2-methyl-1,3-benzoxazol-6-yl)-1-oxacyclohexadec-13-ene-2,6-dione (PubChem CID 142001555) has the molecular formula C28H39NO5 and a molecular weight of 469.62 g/mol. Its IUPAC name is (7R,9S,13Z)-8-hydroxy-5,5,7,9,13-pentamethyl-16-(2-methyl-1,3-benzoxazol-6-yl)-1-oxacyclohexadec-13-ene-2,6-dione.
| Compound Name | (7R,9S,13Z)-8-hydroxy-5,5,7,9,13-pentamethyl-16-(2-methyl-1,3-benzoxazol-6-yl)-1-oxacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 142001555 |
| Molecular Formula | C28H39NO5 |
| Molecular Weight | 469.62 g/mol |
| Exact Mass | 469.28 |
| IUPAC Name | (7R,9S,13Z)-8-hydroxy-5,5,7,9,13-pentamethyl-16-(2-methyl-1,3-benzoxazol-6-yl)-1-oxacyclohexadec-13-ene-2,6-dione |
| SMILES | C/C1=C/CC(c2ccc3nc(C)oc3c2)OC(=O)CCC(C)(C)C(=O)[C@H](C)C(O)[C@@H](C)CCC1 |
| InChI | InChI=1S/C28H39NO5/c1-17-8-7-9-18(2)26(31)19(3)27(32)28(5,6)15-14-25(30)34-23(13-10-17)21-11-12-22-24(16-21)33-20(4)29-22/h10-12,16,18-19,23,26,31H,7-9,13-15H2,1-6H3/b17-10-/t18-,19+,23?,26?/m0/s1 |
| InChIKey | FYGJIWXJRCCAHX-HOSVTDQASA-N |
| XLogP | 6.25 |
| TPSA | 89.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.62 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|