C27H41NO4S — CID 177423867
(7R,9S,13Z,16S)-8-hydroxy-5,5,7,9,13-pentamethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadec-13-ene-2,6-dione (PubChem CID 177423867) has the molecular formula C27H41NO4S and a molecular weight of 475.70 g/mol. Its IUPAC name is (7R,9S,13Z,16S)-8-hydroxy-5,5,7,9,13-pentamethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadec-13-ene-2,6-dione.
| Compound Name | (7R,9S,13Z,16S)-8-hydroxy-5,5,7,9,13-pentamethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 177423867 |
| Molecular Formula | C27H41NO4S |
| Molecular Weight | 475.70 g/mol |
| Exact Mass | 475.28 |
| IUPAC Name | (7R,9S,13Z,16S)-8-hydroxy-5,5,7,9,13-pentamethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadec-13-ene-2,6-dione |
| SMILES | C/C1=C/C[C@@H](/C(C)=C/c2csc(C)n2)OC(=O)CCC(C)(C)C(=O)[C@H](C)C(O)[C@@H](C)CCC1 |
| InChI | InChI=1S/C27H41NO4S/c1-17-9-8-10-18(2)25(30)20(4)26(31)27(6,7)14-13-24(29)32-23(12-11-17)19(3)15-22-16-33-21(5)28-22/h11,15-16,18,20,23,25,30H,8-10,12-14H2,1-7H3/b17-11-,19-15+/t18-,20+,23-,25?/m0/s1 |
| InChIKey | OFFMAOLMRZZNAE-ZDBLGEHISA-N |
| XLogP | 6.30 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.70 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|