C30H47NO4S — CID 142225308
(16R)-11-hydroxy-8,8,10,12,16,17-hexamethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-4-oxabicyclo[14.1.1]octadecane-5,9-dione (PubChem CID 142225308) has the molecular formula C30H47NO4S and a molecular weight of 517.78 g/mol. Its IUPAC name is (16R)-11-hydroxy-8,8,10,12,16,17-hexamethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-4-oxabicyclo[14.1.1]octadecane-5,9-dione.
| Compound Name | (16R)-11-hydroxy-8,8,10,12,16,17-hexamethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-4-oxabicyclo[14.1.1]octadecane-5,9-dione |
|---|---|
| PubChem CID | 142225308 |
| Molecular Formula | C30H47NO4S |
| Molecular Weight | 517.78 g/mol |
| Exact Mass | 517.32 |
| IUPAC Name | (16R)-11-hydroxy-8,8,10,12,16,17-hexamethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-4-oxabicyclo[14.1.1]octadecane-5,9-dione |
| SMILES | C/C(=C\c1csc(C)n1)C1CC2C[C@@](C)(CCCC(C)C(O)C(C)C(=O)C(C)(C)CCC(=O)O1)C2C |
| InChI | InChI=1S/C30H47NO4S/c1-18-10-9-12-30(8)16-23(21(30)4)15-25(19(2)14-24-17-36-22(5)31-24)35-26(32)11-13-29(6,7)28(34)20(3)27(18)33/h14,17-18,20-21,23,25,27,33H,9-13,15-16H2,1-8H3/b19-14+/t18?,20?,21?,23?,25?,27?,30-/m1/s1 |
| InChIKey | JXUNYIWTFQLYQK-ZUXSZWBJSA-N |
| XLogP | 7.01 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.78 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |