C26H39NO4S — CID 163432154
(7R,8S,13Z,16S)-8-hydroxy-5,7,9,13-tetramethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadec-13-ene-2,6-dione (PubChem CID 163432154) has the molecular formula C26H39NO4S and a molecular weight of 461.67 g/mol. Its IUPAC name is (7R,8S,13Z,16S)-8-hydroxy-5,7,9,13-tetramethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadec-13-ene-2,6-dione.
| Compound Name | (7R,8S,13Z,16S)-8-hydroxy-5,7,9,13-tetramethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 163432154 |
| Molecular Formula | C26H39NO4S |
| Molecular Weight | 461.67 g/mol |
| Exact Mass | 461.26 |
| IUPAC Name | (7R,8S,13Z,16S)-8-hydroxy-5,7,9,13-tetramethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadec-13-ene-2,6-dione |
| SMILES | C/C1=C/C[C@@H](/C(C)=C/c2csc(C)n2)OC(=O)CCC(C)C(=O)[C@H](C)[C@@H](O)C(C)CCC1 |
| InChI | InChI=1S/C26H39NO4S/c1-16-8-7-9-17(2)25(29)20(5)26(30)18(3)11-13-24(28)31-23(12-10-16)19(4)14-22-15-32-21(6)27-22/h10,14-15,17-18,20,23,25,29H,7-9,11-13H2,1-6H3/b16-10-,19-14+/t17?,18?,20-,23+,25+/m1/s1 |
| InChIKey | ARKUVRVVLKQVIR-DKHVRTNLSA-N |
| XLogP | 5.91 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.67 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|