C26H41NO4S2 — CID 68875783
(9S,16S)-4,8-dihydroxy-5,5,7,9,13-pentamethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxa-6-thiacyclohexadec-13-en-2-one (PubChem CID 68875783) has the molecular formula C26H41NO4S2 and a molecular weight of 495.75 g/mol. Its IUPAC name is (9S,16S)-4,8-dihydroxy-5,5,7,9,13-pentamethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxa-6-thiacyclohexadec-13-en-2-one.
| Compound Name | (9S,16S)-4,8-dihydroxy-5,5,7,9,13-pentamethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxa-6-thiacyclohexadec-13-en-2-one |
|---|---|
| PubChem CID | 68875783 |
| Molecular Formula | C26H41NO4S2 |
| Molecular Weight | 495.75 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | (9S,16S)-4,8-dihydroxy-5,5,7,9,13-pentamethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxa-6-thiacyclohexadec-13-en-2-one |
| SMILES | CC1=CC[C@@H](C(C)=Cc2csc(C)n2)OC(=O)CC(O)C(C)(C)SC(C)C(O)[C@@H](C)CCC1 |
| InChI | InChI=1S/C26H41NO4S2/c1-16-9-8-10-17(2)25(30)19(4)33-26(6,7)23(28)14-24(29)31-22(12-11-16)18(3)13-21-15-32-20(5)27-21/h11,13,15,17,19,22-23,25,28,30H,8-10,12,14H2,1-7H3/t17-,19?,22-,23?,25?/m0/s1 |
| InChIKey | NJYQMYDUEHIHJT-ZQMLNANVSA-N |
| XLogP | 5.94 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.75 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|