C32H55NO5S — CID 142880353
(7R,8S,9S,13Z,16S)-8-hydroxy-5,5,7,9,13-pentamethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadec-13-ene-2,6-dione;methanol;2-methylpropane (PubChem CID 142880353) has the molecular formula C32H55NO5S and a molecular weight of 565.86 g/mol. Its IUPAC name is (7R,8S,9S,13Z,16S)-8-hydroxy-5,5,7,9,13-pentamethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadec-13-ene-2,6-dione;methanol;2-methylpropane.
| Compound Name | (7R,8S,9S,13Z,16S)-8-hydroxy-5,5,7,9,13-pentamethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadec-13-ene-2,6-dione;methanol;2-methylpropane |
|---|---|
| PubChem CID | 142880353 |
| Molecular Formula | C32H55NO5S |
| Molecular Weight | 565.86 g/mol |
| Exact Mass | 565.38 |
| IUPAC Name | (7R,8S,9S,13Z,16S)-8-hydroxy-5,5,7,9,13-pentamethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadec-13-ene-2,6-dione;methanol;2-methylpropane |
| SMILES | C/C1=C/C[C@@H](/C(C)=C/c2csc(C)n2)OC(=O)CCC(C)(C)C(=O)[C@H](C)[C@@H](O)[C@@H](C)CCC1.CC(C)C.CO |
| InChI | InChI=1S/C27H41NO4S.C4H10.CH4O/c1-17-9-8-10-18(2)25(30)20(4)26(31)27(6,7)14-13-24(29)32-23(12-11-17)19(3)15-22-16-33-21(5)28-22;1-4(2)3;1-2/h11,15-16,18,20,23,25,30H,8-10,12-14H2,1-7H3;4H,1-3H3;2H,1H3/b17-11-,19-15+;;/t18-,20+,23-,25-;;/m0../s1 |
| InChIKey | SYUYHQJLBLPZHH-KPOHZJGNSA-N |
| XLogP | 7.57 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.86 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|