C27H42N2O5S — CID 143690653
[(9S,11R)-10-hydroxy-9,11,13,13-tetramethyl-2-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-12,16-dioxo-oxacyclohexadec-4-yl] methanimidate (PubChem CID 143690653) has the molecular formula C27H42N2O5S and a molecular weight of 506.71 g/mol. Its IUPAC name is [(9S,11R)-10-hydroxy-9,11,13,13-tetramethyl-2-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-12,16-dioxo-oxacyclohexadec-4-yl] methanimidate.
| Compound Name | [(9S,11R)-10-hydroxy-9,11,13,13-tetramethyl-2-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-12,16-dioxo-oxacyclohexadec-4-yl] methanimidate |
|---|---|
| PubChem CID | 143690653 |
| Molecular Formula | C27H42N2O5S |
| Molecular Weight | 506.71 g/mol |
| Exact Mass | 506.28 |
| IUPAC Name | [(9S,11R)-10-hydroxy-9,11,13,13-tetramethyl-2-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-12,16-dioxo-oxacyclohexadec-4-yl] methanimidate |
| SMILES | [H]/N=C/OC1CCCC[C@H](C)C(O)[C@@H](C)C(=O)C(C)(C)CCC(=O)OC(/C(C)=C/c2csc(C)n2)C1 |
| InChI | InChI=1S/C27H42N2O5S/c1-17-9-7-8-10-22(33-16-28)14-23(18(2)13-21-15-35-20(4)29-21)34-24(30)11-12-27(5,6)26(32)19(3)25(17)31/h13,15-17,19,22-23,25,28,31H,7-12,14H2,1-6H3/b18-13+,28-16+/t17-,19+,22?,23?,25?/m0/s1 |
| InChIKey | DHBAPTCCWQHKMX-YAOAWYBQSA-N |
| XLogP | 5.73 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.71 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|