C26H40N2O4S — CID 85422210
8-hydroxy-5,5,7,9,13-pentamethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxa-4-azacyclohexadec-13-ene-2,6-dione (PubChem CID 85422210) has the molecular formula C26H40N2O4S and a molecular weight of 476.68 g/mol. Its IUPAC name is 8-hydroxy-5,5,7,9,13-pentamethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxa-4-azacyclohexadec-13-ene-2,6-dione.
| Compound Name | 8-hydroxy-5,5,7,9,13-pentamethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxa-4-azacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 85422210 |
| Molecular Formula | C26H40N2O4S |
| Molecular Weight | 476.68 g/mol |
| Exact Mass | 476.27 |
| IUPAC Name | 8-hydroxy-5,5,7,9,13-pentamethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxa-4-azacyclohexadec-13-ene-2,6-dione |
| SMILES | CC1=CCC(C(C)=Cc2csc(C)n2)OC(=O)CNC(C)(C)C(=O)C(C)C(O)C(C)CCC1 |
| InChI | InChI=1S/C26H40N2O4S/c1-16-9-8-10-17(2)24(30)19(4)25(31)26(6,7)27-14-23(29)32-22(12-11-16)18(3)13-21-15-33-20(5)28-21/h11,13,15,17,19,22,24,27,30H,8-10,12,14H2,1-7H3 |
| InChIKey | AYVTYADJAZYDHA-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.68 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|