C29H43NO5S — CID 11504530
(5S,9S,11Z,16S,17S,18R)-18-ethyl-5,17-dihydroxy-12,16-dimethyl-9-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-8-oxaspiro[3.15]nonadec-11-ene-7,19-dione (PubChem CID 11504530) has the molecular formula C29H43NO5S and a molecular weight of 517.73 g/mol. Its IUPAC name is (5S,9S,11Z,16S,17S,18R)-18-ethyl-5,17-dihydroxy-12,16-dimethyl-9-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-8-oxaspiro[3.15]nonadec-11-ene-7,19-dione.
| Compound Name | (5S,9S,11Z,16S,17S,18R)-18-ethyl-5,17-dihydroxy-12,16-dimethyl-9-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-8-oxaspiro[3.15]nonadec-11-ene-7,19-dione |
|---|---|
| PubChem CID | 11504530 |
| Molecular Formula | C29H43NO5S |
| Molecular Weight | 517.73 g/mol |
| Exact Mass | 517.29 |
| IUPAC Name | (5S,9S,11Z,16S,17S,18R)-18-ethyl-5,17-dihydroxy-12,16-dimethyl-9-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-8-oxaspiro[3.15]nonadec-11-ene-7,19-dione |
| SMILES | CC[C@H]1C(=O)C2(CCC2)[C@@H](O)CC(=O)O[C@H](/C(C)=C/c2csc(C)n2)C/C=C(/C)CCC[C@H](C)[C@@H]1O |
| InChI | InChI=1S/C29H43NO5S/c1-6-23-27(33)19(3)10-7-9-18(2)11-12-24(20(4)15-22-17-36-21(5)30-22)35-26(32)16-25(31)29(28(23)34)13-8-14-29/h11,15,17,19,23-25,27,31,33H,6-10,12-14,16H2,1-5H3/b18-11-,20-15+/t19-,23+,24-,25-,27-/m0/s1 |
| InChIKey | AZJYXIMNQUKREQ-VJAIHYQXSA-N |
| XLogP | 5.80 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.73 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|