C30H46N4O5S — CID 135271235
(4S,7R,8S,9S,13Z,16S)-7-(4-azidobutyl)-4,8-dihydroxy-5,5,9,13-tetramethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadec-13-ene-2,6-dione (PubChem CID 135271235) has the molecular formula C30H46N4O5S and a molecular weight of 574.79 g/mol. Its IUPAC name is (4S,7R,8S,9S,13Z,16S)-7-(4-azidobutyl)-4,8-dihydroxy-5,5,9,13-tetramethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadec-13-ene-2,6-dione.
| Compound Name | (4S,7R,8S,9S,13Z,16S)-7-(4-azidobutyl)-4,8-dihydroxy-5,5,9,13-tetramethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 135271235 |
| Molecular Formula | C30H46N4O5S |
| Molecular Weight | 574.79 g/mol |
| Exact Mass | 574.32 |
| IUPAC Name | (4S,7R,8S,9S,13Z,16S)-7-(4-azidobutyl)-4,8-dihydroxy-5,5,9,13-tetramethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadec-13-ene-2,6-dione |
| SMILES | C/C1=C/C[C@@H](/C(C)=C/c2csc(C)n2)OC(=O)C[C@H](O)C(C)(C)C(=O)[C@@H](CCCCN=[N+]=[N-])[C@@H](O)[C@@H](C)CCC1 |
| InChI | InChI=1S/C30H46N4O5S/c1-19-10-9-11-20(2)28(37)24(12-7-8-15-32-34-31)29(38)30(5,6)26(35)17-27(36)39-25(14-13-19)21(3)16-23-18-40-22(4)33-23/h13,16,18,20,24-26,28,35,37H,7-12,14-15,17H2,1-6H3/b19-13-,21-16+/t20-,24-,25-,26-,28-/m0/s1 |
| InChIKey | UHXJEGHGVGPVEX-PUTUXVQGSA-N |
| XLogP | 6.73 |
| TPSA | 145.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.79 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|