C28H42ClNO5S — CID 22871147
(4R,7R,8S,9S,13Z,16S)-16-[(Z)-1-chloro-2-(2-methyl-1,3-thiazol-4-yl)ethenyl]-4,8-dihydroxy-5,5,9,13-tetramethyl-7-propyl-1-oxacyclohexadec-13-ene-2,6-dione (PubChem CID 22871147) has the molecular formula C28H42ClNO5S and a molecular weight of 540.17 g/mol. Its IUPAC name is (4R,7R,8S,9S,13Z,16S)-16-[(Z)-1-chloro-2-(2-methyl-1,3-thiazol-4-yl)ethenyl]-4,8-dihydroxy-5,5,9,13-tetramethyl-7-propyl-1-oxacyclohexadec-13-ene-2,6-dione.
| Compound Name | (4R,7R,8S,9S,13Z,16S)-16-[(Z)-1-chloro-2-(2-methyl-1,3-thiazol-4-yl)ethenyl]-4,8-dihydroxy-5,5,9,13-tetramethyl-7-propyl-1-oxacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 22871147 |
| Molecular Formula | C28H42ClNO5S |
| Molecular Weight | 540.17 g/mol |
| Exact Mass | 539.25 |
| IUPAC Name | (4R,7R,8S,9S,13Z,16S)-16-[(Z)-1-chloro-2-(2-methyl-1,3-thiazol-4-yl)ethenyl]-4,8-dihydroxy-5,5,9,13-tetramethyl-7-propyl-1-oxacyclohexadec-13-ene-2,6-dione |
| SMILES | CCC[C@H]1C(=O)C(C)(C)[C@H](O)CC(=O)O[C@H](/C(Cl)=C/c2csc(C)n2)C/C=C(/C)CCC[C@H](C)[C@@H]1O |
| InChI | InChI=1S/C28H42ClNO5S/c1-7-9-21-26(33)18(3)11-8-10-17(2)12-13-23(22(29)14-20-16-36-19(4)30-20)35-25(32)15-24(31)28(5,6)27(21)34/h12,14,16,18,21,23-24,26,31,33H,7-11,13,15H2,1-6H3/b17-12-,22-14-/t18-,21+,23-,24+,26-/m0/s1 |
| InChIKey | HHQNGMSGRKPMFB-YKUDQNEVSA-N |
| XLogP | 6.22 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.17 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|