C27H41ClN2O5S — CID 10325026
(4S,7R,8S,9S,13Z,16S)-16-[(Z)-2-[2-(aminomethyl)-1,3-thiazol-4-yl]-1-chloroethenyl]-7-ethyl-4,8-dihydroxy-5,5,9,13-tetramethyl-1-oxacyclohexadec-13-ene-2,6-dione (PubChem CID 10325026) has the molecular formula C27H41ClN2O5S and a molecular weight of 541.15 g/mol. Its IUPAC name is (4S,7R,8S,9S,13Z,16S)-16-[(Z)-2-[2-(aminomethyl)-1,3-thiazol-4-yl]-1-chloroethenyl]-7-ethyl-4,8-dihydroxy-5,5,9,13-tetramethyl-1-oxacyclohexadec-13-ene-2,6-dione.
| Compound Name | (4S,7R,8S,9S,13Z,16S)-16-[(Z)-2-[2-(aminomethyl)-1,3-thiazol-4-yl]-1-chloroethenyl]-7-ethyl-4,8-dihydroxy-5,5,9,13-tetramethyl-1-oxacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 10325026 |
| Molecular Formula | C27H41ClN2O5S |
| Molecular Weight | 541.15 g/mol |
| Exact Mass | 540.24 |
| IUPAC Name | (4S,7R,8S,9S,13Z,16S)-16-[(Z)-2-[2-(aminomethyl)-1,3-thiazol-4-yl]-1-chloroethenyl]-7-ethyl-4,8-dihydroxy-5,5,9,13-tetramethyl-1-oxacyclohexadec-13-ene-2,6-dione |
| SMILES | CC[C@H]1C(=O)C(C)(C)[C@@H](O)CC(=O)O[C@H](/C(Cl)=C/c2csc(CN)n2)C/C=C(/C)CCC[C@H](C)[C@@H]1O |
| InChI | InChI=1S/C27H41ClN2O5S/c1-6-19-25(33)17(3)9-7-8-16(2)10-11-21(20(28)12-18-15-36-23(14-29)30-18)35-24(32)13-22(31)27(4,5)26(19)34/h10,12,15,17,19,21-22,25,31,33H,6-9,11,13-14,29H2,1-5H3/b16-10-,20-12-/t17-,19+,21-,22-,25-/m0/s1 |
| InChIKey | SDEHDIDMEJANTI-KDDIPNHPSA-N |
| XLogP | 4.98 |
| TPSA | 122.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.15 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|