C33H49NO4 — CID 142001497
cis-(7R,9S)-14-ethyl-8-hydroxy-5,5,7,9,13,13-hexamethyl-16-(2-methylquinolin-6-yl)-oxacyclohexadecane-2,6-dione (PubChem CID 142001497) has the molecular formula C33H49NO4 and a molecular weight of 523.76 g/mol. Its IUPAC name is cis-(7R,9S)-14-ethyl-8-hydroxy-5,5,7,9,13,13-hexamethyl-16-(2-methylquinolin-6-yl)-oxacyclohexadecane-2,6-dione.
| Compound Name | cis-(7R,9S)-14-ethyl-8-hydroxy-5,5,7,9,13,13-hexamethyl-16-(2-methylquinolin-6-yl)-oxacyclohexadecane-2,6-dione |
|---|---|
| PubChem CID | 142001497 |
| Molecular Formula | C33H49NO4 |
| Molecular Weight | 523.76 g/mol |
| Exact Mass | 523.37 |
| IUPAC Name | cis-(7R,9S)-14-ethyl-8-hydroxy-5,5,7,9,13,13-hexamethyl-16-(2-methylquinolin-6-yl)-oxacyclohexadecane-2,6-dione |
| SMILES | CCC1CC(c2ccc3nc(C)ccc3c2)OC(=O)CCC(C)(C)C(=O)[C@H](C)C(O)[C@@H](C)CCCC1(C)C |
| InChI | InChI=1S/C33H49NO4/c1-9-26-20-28(25-14-15-27-24(19-25)13-12-22(3)34-27)38-29(35)16-18-33(7,8)31(37)23(4)30(36)21(2)11-10-17-32(26,5)6/h12-15,19,21,23,26,28,30,36H,9-11,16-18,20H2,1-8H3/t21-,23+,26?,28?,30?/m0/s1 |
| InChIKey | BIRMUHQRMQRUNR-GFPCEHNLSA-N |
| XLogP | 7.76 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.76 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |