C29H41NO5 — CID 142903162
(13Z)-7-ethyl-16-[2-(hydroxymethyl)-1,3-benzoxazol-5-yl]-5,5,9,13-tetramethyl-1-oxacyclohexadec-13-ene-2,6-dione (PubChem CID 142903162) has the molecular formula C29H41NO5 and a molecular weight of 483.65 g/mol. Its IUPAC name is (13Z)-7-ethyl-16-[2-(hydroxymethyl)-1,3-benzoxazol-5-yl]-5,5,9,13-tetramethyl-1-oxacyclohexadec-13-ene-2,6-dione.
| Compound Name | (13Z)-7-ethyl-16-[2-(hydroxymethyl)-1,3-benzoxazol-5-yl]-5,5,9,13-tetramethyl-1-oxacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 142903162 |
| Molecular Formula | C29H41NO5 |
| Molecular Weight | 483.65 g/mol |
| Exact Mass | 483.30 |
| IUPAC Name | (13Z)-7-ethyl-16-[2-(hydroxymethyl)-1,3-benzoxazol-5-yl]-5,5,9,13-tetramethyl-1-oxacyclohexadec-13-ene-2,6-dione |
| SMILES | CCC1CC(C)CCC/C(C)=C\CC(c2ccc3oc(CO)nc3c2)OC(=O)CCC(C)(C)C1=O |
| InChI | InChI=1S/C29H41NO5/c1-6-21-16-20(3)9-7-8-19(2)10-12-24(35-27(32)14-15-29(4,5)28(21)33)22-11-13-25-23(17-22)30-26(18-31)34-25/h10-11,13,17,20-21,24,31H,6-9,12,14-16,18H2,1-5H3/b19-10- |
| InChIKey | JGWYTSRWXJAXJO-GRSHGNNSSA-N |
| XLogP | 6.85 |
| TPSA | 89.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.65 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|