C33H51NO4SSi — CID 154073949
3-[tert-butyl(dimethyl)silyl]oxy-5,5,9,13-tetramethyl-16-(2-methyl-1,3-benzothiazol-5-yl)-1-oxacyclohexadec-13-ene-2,6-dione (PubChem CID 154073949) has the molecular formula C33H51NO4SSi and a molecular weight of 585.93 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]oxy-5,5,9,13-tetramethyl-16-(2-methyl-1,3-benzothiazol-5-yl)-1-oxacyclohexadec-13-ene-2,6-dione.
| Compound Name | 3-[tert-butyl(dimethyl)silyl]oxy-5,5,9,13-tetramethyl-16-(2-methyl-1,3-benzothiazol-5-yl)-1-oxacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 154073949 |
| Molecular Formula | C33H51NO4SSi |
| Molecular Weight | 585.93 g/mol |
| Exact Mass | 585.33 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]oxy-5,5,9,13-tetramethyl-16-(2-methyl-1,3-benzothiazol-5-yl)-1-oxacyclohexadec-13-ene-2,6-dione |
| SMILES | CC1=CCC(c2ccc3sc(C)nc3c2)OC(=O)C(O[Si](C)(C)C(C)(C)C)CC(C)(C)C(=O)CCC(C)CCC1 |
| InChI | InChI=1S/C33H51NO4SSi/c1-22-12-11-13-23(2)15-19-30(35)33(7,8)21-28(38-40(9,10)32(4,5)6)31(36)37-27(17-14-22)25-16-18-29-26(20-25)34-24(3)39-29/h14,16,18,20,23,27-28H,11-13,15,17,19,21H2,1-10H3 |
| InChIKey | RESPRBKJRUTPCD-UHFFFAOYSA-N |
| XLogP | 9.50 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.93 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|