C38H47NO7S — CID 91615070
benzyl [(4S,7R,8S,9S,16S)-4-hydroxy-5,5,9,13-tetramethyl-16-(2-methyl-1,3-benzothiazol-5-yl)-2,6-dioxo-7-prop-2-enyl-1-oxacyclohexadec-13-en-8-yl] carbonate (PubChem CID 91615070) has the molecular formula C38H47NO7S and a molecular weight of 661.86 g/mol. Its IUPAC name is benzyl [(4S,7R,8S,9S,16S)-4-hydroxy-5,5,9,13-tetramethyl-16-(2-methyl-1,3-benzothiazol-5-yl)-2,6-dioxo-7-prop-2-enyl-1-oxacyclohexadec-13-en-8-yl] carbonate.
| Compound Name | benzyl [(4S,7R,8S,9S,16S)-4-hydroxy-5,5,9,13-tetramethyl-16-(2-methyl-1,3-benzothiazol-5-yl)-2,6-dioxo-7-prop-2-enyl-1-oxacyclohexadec-13-en-8-yl] carbonate |
|---|---|
| PubChem CID | 91615070 |
| Molecular Formula | C38H47NO7S |
| Molecular Weight | 661.86 g/mol |
| Exact Mass | 661.31 |
| IUPAC Name | benzyl [(4S,7R,8S,9S,16S)-4-hydroxy-5,5,9,13-tetramethyl-16-(2-methyl-1,3-benzothiazol-5-yl)-2,6-dioxo-7-prop-2-enyl-1-oxacyclohexadec-13-en-8-yl] carbonate |
| SMILES | C=CC[C@H]1C(=O)C(C)(C)[C@@H](O)CC(=O)O[C@H](c2ccc3sc(C)nc3c2)CC=C(C)CCC[C@H](C)[C@@H]1OC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C38H47NO7S/c1-7-12-29-35(46-37(43)44-23-27-15-9-8-10-16-27)25(3)14-11-13-24(2)17-19-31(28-18-20-32-30(21-28)39-26(4)47-32)45-34(41)22-33(40)38(5,6)36(29)42/h7-10,15-18,20-21,25,29,31,33,35,40H,1,11-14,19,22-23H2,2-6H3/t25-,29+,31-,33-,35-/m0/s1 |
| InChIKey | BBDKJMLEJUHUDP-JDULYXRESA-N |
| XLogP | 8.61 |
| TPSA | 112.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.86 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|