C30H46N2O4 — CID 142001518
cis-(7R,9S)-8-hydroxy-5,5,7,9,13,13,14-heptamethyl-16-(3-methylbenzimidazol-5-yl)-oxacyclohexadecane-2,6-dione (PubChem CID 142001518) has the molecular formula C30H46N2O4 and a molecular weight of 498.71 g/mol. Its IUPAC name is cis-(7R,9S)-8-hydroxy-5,5,7,9,13,13,14-heptamethyl-16-(3-methylbenzimidazol-5-yl)-oxacyclohexadecane-2,6-dione.
| Compound Name | cis-(7R,9S)-8-hydroxy-5,5,7,9,13,13,14-heptamethyl-16-(3-methylbenzimidazol-5-yl)-oxacyclohexadecane-2,6-dione |
|---|---|
| PubChem CID | 142001518 |
| Molecular Formula | C30H46N2O4 |
| Molecular Weight | 498.71 g/mol |
| Exact Mass | 498.35 |
| IUPAC Name | cis-(7R,9S)-8-hydroxy-5,5,7,9,13,13,14-heptamethyl-16-(3-methylbenzimidazol-5-yl)-oxacyclohexadecane-2,6-dione |
| SMILES | CC1CC(c2ccc3ncn(C)c3c2)OC(=O)CCC(C)(C)C(=O)[C@H](C)C(O)[C@@H](C)CCCC1(C)C |
| InChI | InChI=1S/C30H46N2O4/c1-19-10-9-14-29(4,5)20(2)16-25(22-11-12-23-24(17-22)32(8)18-31-23)36-26(33)13-15-30(6,7)28(35)21(3)27(19)34/h11-12,17-21,25,27,34H,9-10,13-16H2,1-8H3/t19-,20?,21+,25?,27?/m0/s1 |
| InChIKey | XHTHDDQXPDBBNV-ADJXKVGISA-N |
| XLogP | 6.40 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.71 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |