C35H56N2O4Si — CID 134864200
(4S,8S,13E,16S)-4-[tert-butyl(dimethyl)silyl]oxy-16-(1,2-dimethylbenzimidazol-5-yl)-5,5,7,8,9-pentamethyl-1-oxacyclohexadec-13-ene-2,6-dione (PubChem CID 134864200) has the molecular formula C35H56N2O4Si and a molecular weight of 596.93 g/mol. Its IUPAC name is (4S,8S,13E,16S)-4-[tert-butyl(dimethyl)silyl]oxy-16-(1,2-dimethylbenzimidazol-5-yl)-5,5,7,8,9-pentamethyl-1-oxacyclohexadec-13-ene-2,6-dione.
| Compound Name | (4S,8S,13E,16S)-4-[tert-butyl(dimethyl)silyl]oxy-16-(1,2-dimethylbenzimidazol-5-yl)-5,5,7,8,9-pentamethyl-1-oxacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 134864200 |
| Molecular Formula | C35H56N2O4Si |
| Molecular Weight | 596.93 g/mol |
| Exact Mass | 596.40 |
| IUPAC Name | (4S,8S,13E,16S)-4-[tert-butyl(dimethyl)silyl]oxy-16-(1,2-dimethylbenzimidazol-5-yl)-5,5,7,8,9-pentamethyl-1-oxacyclohexadec-13-ene-2,6-dione |
| SMILES | Cc1nc2cc([C@@H]3C/C=C/CCCC(C)[C@H](C)C(C)C(=O)C(C)(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC(=O)O3)ccc2n1C |
| InChI | InChI=1S/C35H56N2O4Si/c1-23-17-15-13-14-16-18-30(27-19-20-29-28(21-27)36-26(4)37(29)10)40-32(38)22-31(41-42(11,12)34(5,6)7)35(8,9)33(39)25(3)24(23)2/h14,16,19-21,23-25,30-31H,13,15,17-18,22H2,1-12H3/b16-14+/t23?,24-,25?,30-,31-/m0/s1 |
| InChIKey | IDEMJKRJGPLFBT-GBPDTHFGSA-N |
| XLogP | 8.88 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.93 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|