C36H60N2O5Si — CID 134864260
methyl (Z,3S,7S,15S)-3-[tert-butyl(dimethyl)silyl]oxy-15-(1,2-dimethylbenzimidazol-5-yl)-15-hydroxy-4,4,6,7,8-pentamethyl-5-oxopentadec-12-enoate (PubChem CID 134864260) has the molecular formula C36H60N2O5Si and a molecular weight of 628.97 g/mol. Its IUPAC name is methyl (Z,3S,7S,15S)-3-[tert-butyl(dimethyl)silyl]oxy-15-(1,2-dimethylbenzimidazol-5-yl)-15-hydroxy-4,4,6,7,8-pentamethyl-5-oxopentadec-12-enoate.
| Compound Name | methyl (Z,3S,7S,15S)-3-[tert-butyl(dimethyl)silyl]oxy-15-(1,2-dimethylbenzimidazol-5-yl)-15-hydroxy-4,4,6,7,8-pentamethyl-5-oxopentadec-12-enoate |
|---|---|
| PubChem CID | 134864260 |
| Molecular Formula | C36H60N2O5Si |
| Molecular Weight | 628.97 g/mol |
| Exact Mass | 628.43 |
| IUPAC Name | methyl (Z,3S,7S,15S)-3-[tert-butyl(dimethyl)silyl]oxy-15-(1,2-dimethylbenzimidazol-5-yl)-15-hydroxy-4,4,6,7,8-pentamethyl-5-oxopentadec-12-enoate |
| SMILES | COC(=O)C[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)C(=O)C(C)[C@@H](C)C(C)CCC/C=C\C[C@H](O)c1ccc2c(c1)nc(C)n2C |
| InChI | InChI=1S/C36H60N2O5Si/c1-24(18-16-14-15-17-19-31(39)28-20-21-30-29(22-28)37-27(4)38(30)10)25(2)26(3)34(41)36(8,9)32(23-33(40)42-11)43-44(12,13)35(5,6)7/h15,17,20-22,24-26,31-32,39H,14,16,18-19,23H2,1-13H3/b17-15-/t24?,25-,26?,31-,32-/m0/s1 |
| InChIKey | CESKMMNAAFDEKJ-CQSKWZBZSA-N |
| XLogP | 8.49 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.97 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|