C29H42N2O5 — CID 134864199
(1S,3S,11S,16R)-3-(1,2-dimethylbenzimidazol-5-yl)-7,11-dihydroxy-8,8,10,12-tetramethyl-4-oxabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 134864199) has the molecular formula C29H42N2O5 and a molecular weight of 498.66 g/mol. Its IUPAC name is (1S,3S,11S,16R)-3-(1,2-dimethylbenzimidazol-5-yl)-7,11-dihydroxy-8,8,10,12-tetramethyl-4-oxabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | (1S,3S,11S,16R)-3-(1,2-dimethylbenzimidazol-5-yl)-7,11-dihydroxy-8,8,10,12-tetramethyl-4-oxabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 134864199 |
| Molecular Formula | C29H42N2O5 |
| Molecular Weight | 498.66 g/mol |
| Exact Mass | 498.31 |
| IUPAC Name | (1S,3S,11S,16R)-3-(1,2-dimethylbenzimidazol-5-yl)-7,11-dihydroxy-8,8,10,12-tetramethyl-4-oxabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | Cc1nc2cc([C@@H]3C[C@@H]4C[C@H]4CCCC(C)[C@H](O)C(C)C(=O)C(C)(C)C(O)CC(=O)O3)ccc2n1C |
| InChI | InChI=1S/C29H42N2O5/c1-16-8-7-9-19-12-21(19)14-24(20-10-11-23-22(13-20)30-18(3)31(23)6)36-26(33)15-25(32)29(4,5)28(35)17(2)27(16)34/h10-11,13,16-17,19,21,24-25,27,32,34H,7-9,12,14-15H2,1-6H3/t16?,17?,19-,21+,24+,25?,27+/m1/s1 |
| InChIKey | BNEVSCPIBMLZGL-UVXPCYIYSA-N |
| XLogP | 4.66 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.66 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |