C36H58N2O4Si — CID 134864201
(3S,7S,11S)-7-[tert-butyl(dimethyl)silyl]oxy-3-(1,2-dimethylbenzimidazol-5-yl)-8,8,10,11,12-pentamethyl-4-oxabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 134864201) has the molecular formula C36H58N2O4Si and a molecular weight of 610.96 g/mol. Its IUPAC name is (3S,7S,11S)-7-[tert-butyl(dimethyl)silyl]oxy-3-(1,2-dimethylbenzimidazol-5-yl)-8,8,10,11,12-pentamethyl-4-oxabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | (3S,7S,11S)-7-[tert-butyl(dimethyl)silyl]oxy-3-(1,2-dimethylbenzimidazol-5-yl)-8,8,10,11,12-pentamethyl-4-oxabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 134864201 |
| Molecular Formula | C36H58N2O4Si |
| Molecular Weight | 610.96 g/mol |
| Exact Mass | 610.42 |
| IUPAC Name | (3S,7S,11S)-7-[tert-butyl(dimethyl)silyl]oxy-3-(1,2-dimethylbenzimidazol-5-yl)-8,8,10,11,12-pentamethyl-4-oxabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | Cc1nc2cc([C@@H]3CC4CC4CCCC(C)[C@H](C)C(C)C(=O)C(C)(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC(=O)O3)ccc2n1C |
| InChI | InChI=1S/C36H58N2O4Si/c1-22-14-13-15-26-18-28(26)20-31(27-16-17-30-29(19-27)37-25(4)38(30)10)41-33(39)21-32(42-43(11,12)35(5,6)7)36(8,9)34(40)24(3)23(22)2/h16-17,19,22-24,26,28,31-32H,13-15,18,20-21H2,1-12H3/t22?,23-,24?,26?,28?,31-,32-/m0/s1 |
| InChIKey | JHVBCYGICKXIRZ-WLXNJVGPSA-N |
| XLogP | 8.96 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.96 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|