C37H62N2O5Si — CID 134864261
methyl (3S,7S)-3-[tert-butyl(dimethyl)silyl]oxy-11-[2-[(2S)-2-(1,2-dimethylbenzimidazol-5-yl)-2-hydroxyethyl]cyclopropyl]-4,4,6,7,8-pentamethyl-5-oxoundecanoate (PubChem CID 134864261) has the molecular formula C37H62N2O5Si and a molecular weight of 643.00 g/mol. Its IUPAC name is methyl (3S,7S)-3-[tert-butyl(dimethyl)silyl]oxy-11-[2-[(2S)-2-(1,2-dimethylbenzimidazol-5-yl)-2-hydroxyethyl]cyclopropyl]-4,4,6,7,8-pentamethyl-5-oxoundecanoate.
| Compound Name | methyl (3S,7S)-3-[tert-butyl(dimethyl)silyl]oxy-11-[2-[(2S)-2-(1,2-dimethylbenzimidazol-5-yl)-2-hydroxyethyl]cyclopropyl]-4,4,6,7,8-pentamethyl-5-oxoundecanoate |
|---|---|
| PubChem CID | 134864261 |
| Molecular Formula | C37H62N2O5Si |
| Molecular Weight | 643.00 g/mol |
| Exact Mass | 642.44 |
| IUPAC Name | methyl (3S,7S)-3-[tert-butyl(dimethyl)silyl]oxy-11-[2-[(2S)-2-(1,2-dimethylbenzimidazol-5-yl)-2-hydroxyethyl]cyclopropyl]-4,4,6,7,8-pentamethyl-5-oxoundecanoate |
| SMILES | COC(=O)C[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)C(=O)C(C)[C@@H](C)C(C)CCCC1CC1C[C@H](O)c1ccc2c(c1)nc(C)n2C |
| InChI | InChI=1S/C37H62N2O5Si/c1-23(15-14-16-27-19-29(27)21-32(40)28-17-18-31-30(20-28)38-26(4)39(31)10)24(2)25(3)35(42)37(8,9)33(22-34(41)43-11)44-45(12,13)36(5,6)7/h17-18,20,23-25,27,29,32-33,40H,14-16,19,21-22H2,1-13H3/t23?,24-,25?,27?,29?,32-,33-/m0/s1 |
| InChIKey | KPZWTDRSFWKVIT-FTXAEMKWSA-N |
| XLogP | 8.57 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.00 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|