C32H49N3O6 — CID 59890418
(1S,3S,11S,16R)-3-[1-[2-(dimethylamino)ethyl]-2-methylbenzimidazol-5-yl]-7,11-dihydroxy-8,8,10,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 59890418) has the molecular formula C32H49N3O6 and a molecular weight of 571.76 g/mol. Its IUPAC name is (1S,3S,11S,16R)-3-[1-[2-(dimethylamino)ethyl]-2-methylbenzimidazol-5-yl]-7,11-dihydroxy-8,8,10,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | (1S,3S,11S,16R)-3-[1-[2-(dimethylamino)ethyl]-2-methylbenzimidazol-5-yl]-7,11-dihydroxy-8,8,10,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 59890418 |
| Molecular Formula | C32H49N3O6 |
| Molecular Weight | 571.76 g/mol |
| Exact Mass | 571.36 |
| IUPAC Name | (1S,3S,11S,16R)-3-[1-[2-(dimethylamino)ethyl]-2-methylbenzimidazol-5-yl]-7,11-dihydroxy-8,8,10,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | Cc1nc2cc([C@@H]3C[C@@H]4O[C@]4(C)CCCC(C)[C@H](O)C(C)C(=O)C(C)(C)C(O)CC(=O)O3)ccc2n1CCN(C)C |
| InChI | InChI=1S/C32H49N3O6/c1-19-10-9-13-32(6)27(41-32)17-25(40-28(37)18-26(36)31(4,5)30(39)20(2)29(19)38)22-11-12-24-23(16-22)33-21(3)35(24)15-14-34(7)8/h11-12,16,19-20,25-27,29,36,38H,9-10,13-15,17-18H2,1-8H3/t19?,20?,25-,26?,27-,29-,32+/m0/s1 |
| InChIKey | IUEZJUMQRLDAAC-XCVMSONKSA-N |
| XLogP | 4.20 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.76 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|