C30H45N3O6 — CID 59890419
(1S,3S,11S,16R)-3-[1-(2-aminoethyl)-2-methylbenzimidazol-5-yl]-7,11-dihydroxy-8,8,10,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 59890419) has the molecular formula C30H45N3O6 and a molecular weight of 543.71 g/mol. Its IUPAC name is (1S,3S,11S,16R)-3-[1-(2-aminoethyl)-2-methylbenzimidazol-5-yl]-7,11-dihydroxy-8,8,10,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | (1S,3S,11S,16R)-3-[1-(2-aminoethyl)-2-methylbenzimidazol-5-yl]-7,11-dihydroxy-8,8,10,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 59890419 |
| Molecular Formula | C30H45N3O6 |
| Molecular Weight | 543.71 g/mol |
| Exact Mass | 543.33 |
| IUPAC Name | (1S,3S,11S,16R)-3-[1-(2-aminoethyl)-2-methylbenzimidazol-5-yl]-7,11-dihydroxy-8,8,10,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | Cc1nc2cc([C@@H]3C[C@@H]4O[C@]4(C)CCCC(C)[C@H](O)C(C)C(=O)C(C)(C)C(O)CC(=O)O3)ccc2n1CCN |
| InChI | InChI=1S/C30H45N3O6/c1-17-8-7-11-30(6)25(39-30)15-23(20-9-10-22-21(14-20)32-19(3)33(22)13-12-31)38-26(35)16-24(34)29(4,5)28(37)18(2)27(17)36/h9-10,14,17-18,23-25,27,34,36H,7-8,11-13,15-16,31H2,1-6H3/t17?,18?,23-,24?,25-,27-,30+/m0/s1 |
| InChIKey | OECWCCYOHZEYER-ZASXCBCNSA-N |
| XLogP | 3.60 |
| TPSA | 140.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.71 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|