C30H43NO6 — CID 10239333
(3S,7R,10R,11S,12R)-10-but-3-enyl-7,11-dihydroxy-8,8,12,16-tetramethyl-3-[(E)-2-pyridin-2-ylethenyl]-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 10239333) has the molecular formula C30H43NO6 and a molecular weight of 513.68 g/mol. Its IUPAC name is (3S,7R,10R,11S,12R)-10-but-3-enyl-7,11-dihydroxy-8,8,12,16-tetramethyl-3-[(E)-2-pyridin-2-ylethenyl]-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | (3S,7R,10R,11S,12R)-10-but-3-enyl-7,11-dihydroxy-8,8,12,16-tetramethyl-3-[(E)-2-pyridin-2-ylethenyl]-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 10239333 |
| Molecular Formula | C30H43NO6 |
| Molecular Weight | 513.68 g/mol |
| Exact Mass | 513.31 |
| IUPAC Name | (3S,7R,10R,11S,12R)-10-but-3-enyl-7,11-dihydroxy-8,8,12,16-tetramethyl-3-[(E)-2-pyridin-2-ylethenyl]-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | C=CCC[C@H]1C(=O)C(C)(C)[C@H](O)CC(=O)O[C@H](/C=C/c2ccccn2)CC2OC2(C)CCC[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C30H43NO6/c1-6-7-13-23-27(34)20(2)11-10-16-30(5)25(37-30)18-22(15-14-21-12-8-9-17-31-21)36-26(33)19-24(32)29(3,4)28(23)35/h6,8-9,12,14-15,17,20,22-25,27,32,34H,1,7,10-11,13,16,18-19H2,2-5H3/b15-14+/t20-,22-,23-,24-,25?,27+,30?/m1/s1 |
| InChIKey | BJMQQYJYUVETJK-BVLRRHBZSA-N |
| XLogP | 4.66 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.68 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|